C18H21N7NaO — CID 70545917
CID 70545917 (PubChem CID 70545917) has the molecular formula C18H21N7NaO and a molecular weight of 374.40 g/mol.
| Compound Name | CID 70545917 |
|---|---|
| PubChem CID | 70545917 |
| Molecular Formula | C18H21N7NaO |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | — |
| SMILES | CCN(CC)c1ccc(-c2cc(C)cc(C(=O)Nc3nn[nH]n3)n2)cc1.[Na] |
| InChI | InChI=1S/C18H21N7O.Na/c1-4-25(5-2)14-8-6-13(7-9-14)15-10-12(3)11-16(19-15)17(26)20-18-21-23-24-22-18;/h6-11H,4-5H2,1-3H3,(H2,20,21,22,23,24,26); |
| InChIKey | NGSNWKNZROJZBH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |