C8H8N6NaO — CID 70476554
CID 70476554 (PubChem CID 70476554) has the molecular formula C8H8N6NaO and a molecular weight of 227.18 g/mol.
| Compound Name | CID 70476554 |
|---|---|
| PubChem CID | 70476554 |
| Molecular Formula | C8H8N6NaO |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C(=O)Nc2nn[nH]n2)n1.[Na] |
| InChI | InChI=1S/C8H8N6O.Na/c1-5-3-2-4-6(9-5)7(15)10-8-11-13-14-12-8;/h2-4H,1H3,(H2,10,11,12,13,14,15); |
| InChIKey | QVPTUWODTQUZTH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |