C14H20N6O — CID 96523879
2-methyl-3-[[(2S)-3-methylbutan-2-yl]amino]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 96523879) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-methyl-3-[[(2S)-3-methylbutan-2-yl]amino]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 2-methyl-3-[[(2S)-3-methylbutan-2-yl]amino]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 96523879 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-methyl-3-[[(2S)-3-methylbutan-2-yl]amino]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | Cc1c(N[C@@H](C)C(C)C)cccc1C(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C14H20N6O/c1-8(2)10(4)15-12-7-5-6-11(9(12)3)13(21)16-14-17-19-20-18-14/h5-8,10,15H,1-4H3,(H2,16,17,18,19,20,21)/t10-/m0/s1 |
| InChIKey | FUHDVSMBXMLPGX-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |