C16H29Cl2N3O — CID 119407414
N-(3-aminopropyl)-2-methyl-3-(3-methylbutan-2-ylamino)benzamide;dihydrochloride (PubChem CID 119407414) has the molecular formula C16H29Cl2N3O and a molecular weight of 350.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-methyl-3-(3-methylbutan-2-ylamino)benzamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-methyl-3-(3-methylbutan-2-ylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119407414 |
| Molecular Formula | C16H29Cl2N3O |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(3-aminopropyl)-2-methyl-3-(3-methylbutan-2-ylamino)benzamide;dihydrochloride |
| SMILES | Cc1c(NC(C)C(C)C)cccc1C(=O)NCCCN.Cl.Cl |
| InChI | InChI=1S/C16H27N3O.2ClH/c1-11(2)13(4)19-15-8-5-7-14(12(15)3)16(20)18-10-6-9-17;;/h5,7-8,11,13,19H,6,9-10,17H2,1-4H3,(H,18,20);2*1H |
| InChIKey | XUBDQNYHPGMJHF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|