C27H33N5O2 — CID 1019302
2-N,6-N-bis[4-(diethylamino)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 1019302) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(diethylamino)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(diethylamino)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 1019302 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2-N,6-N-bis[4-(diethylamino)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(N(CC)CC)cc3)n2)cc1 |
| InChI | InChI=1S/C27H33N5O2/c1-5-31(6-2)22-16-12-20(13-17-22)28-26(33)24-10-9-11-25(30-24)27(34)29-21-14-18-23(19-15-21)32(7-3)8-4/h9-19H,5-8H2,1-4H3,(H,28,33)(H,29,34) |
| InChIKey | WMDQVUBOQHVTBA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|