C19H25N5O2 — CID 109096394
2-N-[2-(dimethylamino)ethyl]-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 109096394) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096394 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-6-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc(C(=O)Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C19H25N5O2/c1-23(2)13-12-20-18(25)16-6-5-7-17(22-16)19(26)21-14-8-10-15(11-9-14)24(3)4/h5-11H,12-13H2,1-4H3,(H,20,25)(H,21,26) |
| InChIKey | KMWVWMNQQOZZNH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|