C18H20N4O2 — CID 109093956
6-N-cyclopropyl-2-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 109093956) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-N-cyclopropyl-2-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-cyclopropyl-2-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109093956 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-N-cyclopropyl-2-N-[4-(dimethylamino)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(C(=O)NC3CC3)n2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-22(2)14-10-8-13(9-11-14)20-18(24)16-5-3-4-15(21-16)17(23)19-12-6-7-12/h3-5,8-12H,6-7H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | WAOONYPIZHIHTI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|