C23H32N4O2 — CID 109099835
2-N-[4-(diethylamino)phenyl]-6-N,6-N-dipropylpyridine-2,6-dicarboxamide (PubChem CID 109099835) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-N-[4-(diethylamino)phenyl]-6-N,6-N-dipropylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[4-(diethylamino)phenyl]-6-N,6-N-dipropylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099835 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-N-[4-(diethylamino)phenyl]-6-N,6-N-dipropylpyridine-2,6-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)Nc2ccc(N(CC)CC)cc2)n1 |
| InChI | InChI=1S/C23H32N4O2/c1-5-16-27(17-6-2)23(29)21-11-9-10-20(25-21)22(28)24-18-12-14-19(15-13-18)26(7-3)8-4/h9-15H,5-8,16-17H2,1-4H3,(H,24,28) |
| InChIKey | QARTZNNMRWYXMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|