C24H18ClN3O2 — CID 20896243
N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]benzamide (PubChem CID 20896243) has the molecular formula C24H18ClN3O2 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]benzamide.
| Compound Name | N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 20896243 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]benzamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)nc(NC(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H18ClN3O2/c1-30-20-13-9-17(10-14-20)22-15-21(16-7-11-19(25)12-8-16)26-24(27-22)28-23(29)18-5-3-2-4-6-18/h2-15H,1H3,(H,26,27,28,29) |
| InChIKey | KOCKVCGMWNBNNF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |