C22H14ClFN4O — CID 155927543
N-[4-(4-chlorophenyl)-6-(4-fluorophenyl)pyrimidin-2-yl]pyridine-3-carboxamide (PubChem CID 155927543) has the molecular formula C22H14ClFN4O and a molecular weight of 404.83 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-6-(4-fluorophenyl)pyrimidin-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-6-(4-fluorophenyl)pyrimidin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155927543 |
| Molecular Formula | C22H14ClFN4O |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[4-(4-chlorophenyl)-6-(4-fluorophenyl)pyrimidin-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)cc(-c2ccc(Cl)cc2)n1)c1cccnc1 |
| InChI | InChI=1S/C22H14ClFN4O/c23-17-7-3-14(4-8-17)19-12-20(15-5-9-18(24)10-6-15)27-22(26-19)28-21(29)16-2-1-11-25-13-16/h1-13H,(H,26,27,28,29) |
| InChIKey | KALGXVHKCFZOGR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |