C19H15ClN2O — CID 110442905
N-[2-(4-chlorophenyl)-4-methylphenyl]pyridine-3-carboxamide (PubChem CID 110442905) has the molecular formula C19H15ClN2O and a molecular weight of 322.80 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-methylphenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-methylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110442905 |
| Molecular Formula | C19H15ClN2O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-methylphenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccnc2)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H15ClN2O/c1-13-4-9-18(22-19(23)15-3-2-10-21-12-15)17(11-13)14-5-7-16(20)8-6-14/h2-12H,1H3,(H,22,23) |
| InChIKey | ZTNVQRXMMSLTJN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |