C14H13ClN4OS — CID 1490574
1-(4-chloro-2-methylphenyl)-3-(pyridine-3-carbonylamino)thiourea (PubChem CID 1490574) has the molecular formula C14H13ClN4OS and a molecular weight of 320.81 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-(pyridine-3-carbonylamino)thiourea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-(pyridine-3-carbonylamino)thiourea |
|---|---|
| PubChem CID | 1490574 |
| Molecular Formula | C14H13ClN4OS |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-(pyridine-3-carbonylamino)thiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C14H13ClN4OS/c1-9-7-11(15)4-5-12(9)17-14(21)19-18-13(20)10-3-2-6-16-8-10/h2-8H,1H3,(H,18,20)(H2,17,19,21) |
| InChIKey | SNEYJMIFOHEREN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|