C13H9ClN2O3 — CID 16772480
4-chloro-2-(pyridine-3-carbonylamino)benzoic acid (PubChem CID 16772480) has the molecular formula C13H9ClN2O3 and a molecular weight of 276.68 g/mol. Its IUPAC name is 4-chloro-2-(pyridine-3-carbonylamino)benzoic acid.
| Compound Name | 4-chloro-2-(pyridine-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 16772480 |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-chloro-2-(pyridine-3-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C13H9ClN2O3/c14-9-3-4-10(13(18)19)11(6-9)16-12(17)8-2-1-5-15-7-8/h1-7H,(H,16,17)(H,18,19) |
| InChIKey | CGNMRXYXDJIALC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |