C20H14ClN3O3 — CID 142865834
5-chloro-2-[[3-(pyridine-3-carboximidoyl)benzoyl]amino]benzoic acid (PubChem CID 142865834) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is 5-chloro-2-[[3-(pyridine-3-carboximidoyl)benzoyl]amino]benzoic acid.
| Compound Name | 5-chloro-2-[[3-(pyridine-3-carboximidoyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142865834 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-chloro-2-[[3-(pyridine-3-carboximidoyl)benzoyl]amino]benzoic acid |
| SMILES | [H]/N=C(\c1cccnc1)c1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)O)c1 |
| InChI | InChI=1S/C20H14ClN3O3/c21-15-6-7-17(16(10-15)20(26)27)24-19(25)13-4-1-3-12(9-13)18(22)14-5-2-8-23-11-14/h1-11,22H,(H,24,25)(H,26,27)/b22-18- |
| InChIKey | MRCSYVMHVDMMTP-PYCFMQQDSA-N |
| XLogP | 4.10 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|