C20H14ClFN4O2 — CID 23107976
N-[4-chloro-2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 23107976) has the molecular formula C20H14ClFN4O2 and a molecular weight of 396.81 g/mol. Its IUPAC name is N-[4-chloro-2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23107976 |
| Molecular Formula | C20H14ClFN4O2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[4-chloro-2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)N/N=C/c1cccc(F)c1)c1cccnc1 |
| InChI | InChI=1S/C20H14ClFN4O2/c21-15-6-7-18(25-19(27)14-4-2-8-23-12-14)17(10-15)20(28)26-24-11-13-3-1-5-16(22)9-13/h1-12H,(H,25,27)(H,26,28)/b24-11+ |
| InChIKey | RLGFXNFPZKPHGB-BHGWPJFGSA-N |
| XLogP | 3.89 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|