C29H34ClN5O3 — CID 23107530
5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 23107530) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107530 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 5-chloro-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)N/N=C/c2cccc(O)c2)c1 |
| InChI | InChI=1S/C29H34ClN5O3/c1-4-35(5-2)15-14-34(3)20-22-9-6-10-23(16-22)28(37)32-27-13-12-24(30)18-26(27)29(38)33-31-19-21-8-7-11-25(36)17-21/h6-13,16-19,36H,4-5,14-15,20H2,1-3H3,(H,32,37)(H,33,38)/b31-19+ |
| InChIKey | DHDQOIBNHZGFCI-ZCTHSVRISA-N |
| XLogP | 4.84 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|