C35H46FN5O6 — CID 23107622
2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide (PubChem CID 23107622) has the molecular formula C35H46FN5O6 and a molecular weight of 651.78 g/mol. Its IUPAC name is 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide.
| Compound Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 23107622 |
| Molecular Formula | C35H46FN5O6 |
| Molecular Weight | 651.78 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2cc(OCCOC)c(OCCOC)cc2C(=O)N/N=C/c2cccc(F)c2)c1 |
| InChI | InChI=1S/C35H46FN5O6/c1-6-41(7-2)15-14-40(3)25-27-11-8-12-28(20-27)34(42)38-31-23-33(47-19-17-45-5)32(46-18-16-44-4)22-30(31)35(43)39-37-24-26-10-9-13-29(36)21-26/h8-13,20-24H,6-7,14-19,25H2,1-5H3,(H,38,42)(H,39,43)/b37-24+ |
| InChIKey | RMJZIKONQAPBLV-HWLOXFRGSA-N |
| XLogP | 4.67 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|