C31H36FN3O8S — CID 66639000
2-[[3-(2,3-dihydroxypropylsulfanylmethyl)benzoyl]amino]-N-[(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide (PubChem CID 66639000) has the molecular formula C31H36FN3O8S and a molecular weight of 629.71 g/mol. Its IUPAC name is 2-[[3-(2,3-dihydroxypropylsulfanylmethyl)benzoyl]amino]-N-[(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide.
| Compound Name | 2-[[3-(2,3-dihydroxypropylsulfanylmethyl)benzoyl]amino]-N-[(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 66639000 |
| Molecular Formula | C31H36FN3O8S |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | 2-[[3-(2,3-dihydroxypropylsulfanylmethyl)benzoyl]amino]-N-[(3-fluorophenyl)methylideneamino]-4,5-bis(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1cc(NC(=O)c2cccc(CSCC(O)CO)c2)c(C(=O)NN=Cc2cccc(F)c2)cc1OCCOC |
| InChI | InChI=1S/C31H36FN3O8S/c1-40-9-11-42-28-15-26(31(39)35-33-17-21-5-4-8-24(32)14-21)27(16-29(28)43-12-10-41-2)34-30(38)23-7-3-6-22(13-23)19-44-20-25(37)18-36/h3-8,13-17,25,36-37H,9-12,18-20H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | KTOPNRAKCUTTEE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|