C28H30BrFN4O4 — CID 66638679
2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-fluorophenyl)methylideneamino]benzamide (PubChem CID 66638679) has the molecular formula C28H30BrFN4O4 and a molecular weight of 585.47 g/mol. Its IUPAC name is 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-fluorophenyl)methylideneamino]benzamide.
| Compound Name | 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-fluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66638679 |
| Molecular Formula | C28H30BrFN4O4 |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-fluorophenyl)methylideneamino]benzamide |
| SMILES | CC(O)CN(Cc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)NN=Cc2cccc(F)c2)cc1)CC(C)O |
| InChI | InChI=1S/C28H30BrFN4O4/c1-18(35)15-34(16-19(2)36)17-20-6-8-22(9-7-20)27(37)32-26-11-10-23(29)13-25(26)28(38)33-31-14-21-4-3-5-24(30)12-21/h3-14,18-19,35-36H,15-17H2,1-2H3,(H,32,37)(H,33,38) |
| InChIKey | ULWNYVBRVKLCEW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|