C31H28BrFN4O4 — CID 23107943
5-bromo-N-[(E)-(3-fluorophenyl)methylideneamino]-2-[[4-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]benzoyl]amino]benzamide (PubChem CID 23107943) has the molecular formula C31H28BrFN4O4 and a molecular weight of 619.49 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(3-fluorophenyl)methylideneamino]-2-[[4-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(E)-(3-fluorophenyl)methylideneamino]-2-[[4-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 23107943 |
| Molecular Formula | C31H28BrFN4O4 |
| Molecular Weight | 619.49 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 5-bromo-N-[(E)-(3-fluorophenyl)methylideneamino]-2-[[4-[[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-methylamino]methyl]benzoyl]amino]benzamide |
| SMILES | CN(Cc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)N/N=C/c2cccc(F)c2)cc1)CC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H28BrFN4O4/c1-37(19-29(39)22-9-12-26(38)13-10-22)18-20-5-7-23(8-6-20)30(40)35-28-14-11-24(32)16-27(28)31(41)36-34-17-21-3-2-4-25(33)15-21/h2-17,29,38-39H,18-19H2,1H3,(H,35,40)(H,36,41)/b34-17+ |
| InChIKey | XHSSZMBRYJDETJ-KVAAJVFYSA-N |
| XLogP | 5.48 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|