C29H29BrClF3N4O4 — CID 66638714
2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 66638714) has the molecular formula C29H29BrClF3N4O4 and a molecular weight of 669.93 g/mol. Its IUPAC name is 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 66638714 |
| Molecular Formula | C29H29BrClF3N4O4 |
| Molecular Weight | 669.93 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | 2-[[4-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-bromo-N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | CC(O)CN(Cc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)NN=Cc2ccc(Cl)c(C(F)(F)F)c2)cc1)CC(C)O |
| InChI | InChI=1S/C29H29BrClF3N4O4/c1-17(39)14-38(15-18(2)40)16-19-3-6-21(7-4-19)27(41)36-26-10-8-22(30)12-23(26)28(42)37-35-13-20-5-9-25(31)24(11-20)29(32,33)34/h3-13,17-18,39-40H,14-16H2,1-2H3,(H,36,41)(H,37,42) |
| InChIKey | ZBZRQGDSKJCBRK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.93 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|