C34H40ClF3N6O2S — CID 66640502
N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-thiomorpholin-4-ylbenzamide (PubChem CID 66640502) has the molecular formula C34H40ClF3N6O2S and a molecular weight of 689.25 g/mol. Its IUPAC name is N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-thiomorpholin-4-ylbenzamide.
| Compound Name | N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-thiomorpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 66640502 |
| Molecular Formula | C34H40ClF3N6O2S |
| Molecular Weight | 689.25 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-thiomorpholin-4-ylbenzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(N3CCSCC3)cc2C(=O)N/N=C\c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C34H40ClF3N6O2S/c1-4-43(5-2)14-13-42(3)23-25-7-6-8-26(19-25)32(45)40-31-12-10-27(44-15-17-47-18-16-44)21-28(31)33(46)41-39-22-24-9-11-30(35)29(20-24)34(36,37)38/h6-12,19-22H,4-5,13-18,23H2,1-3H3,(H,40,45)(H,41,46)/b39-22- |
| InChIKey | JQSRJMZBLYHYCH-PQKVGRGHSA-N |
| XLogP | 6.70 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.25 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|