C31H29ClF3N7O3 — CID 86709224
N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(hydroxymethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 86709224) has the molecular formula C31H29ClF3N7O3 and a molecular weight of 640.07 g/mol. Its IUPAC name is N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(hydroxymethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(hydroxymethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 86709224 |
| Molecular Formula | C31H29ClF3N7O3 |
| Molecular Weight | 640.07 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | N-[(Z)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(hydroxymethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1C(=O)N/N=C\c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(Cn2cc(CO)nn2)c1 |
| InChI | InChI=1S/C31H29ClF3N7O3/c32-27-9-7-20(14-26(27)31(33,34)35)16-36-39-30(45)25-15-24(41-11-2-1-3-12-41)8-10-28(25)37-29(44)22-6-4-5-21(13-22)17-42-18-23(19-43)38-40-42/h4-10,13-16,18,43H,1-3,11-12,17,19H2,(H,37,44)(H,39,45)/b36-16- |
| InChIKey | OIMQCHGXUCVZEI-HTVDVWKISA-N |
| XLogP | 5.50 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.07 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|