C31H30ClF3N4O4S — CID 58712843
3-[[3-[[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid (PubChem CID 58712843) has the molecular formula C31H30ClF3N4O4S and a molecular weight of 647.12 g/mol. Its IUPAC name is 3-[[3-[[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 58712843 |
| Molecular Formula | C31H30ClF3N4O4S |
| Molecular Weight | 647.12 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | 3-[[3-[[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)N/N=C/c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C31H30ClF3N4O4S/c32-26-9-7-20(16-25(26)31(33,34)35)18-36-38-30(43)24-17-23(39-12-2-1-3-13-39)8-10-27(24)37-29(42)22-6-4-5-21(15-22)19-44-14-11-28(40)41/h4-10,15-18H,1-3,11-14,19H2,(H,37,42)(H,38,43)(H,40,41)/b36-18+ |
| InChIKey | YSIGAINAUIKDSX-IZYHBKOJSA-N |
| XLogP | 7.07 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.12 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|