C32H31ClF3N7O3 — CID 87060866
N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 87060866) has the molecular formula C32H31ClF3N7O3 and a molecular weight of 654.09 g/mol. Its IUPAC name is N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 87060866 |
| Molecular Formula | C32H31ClF3N7O3 |
| Molecular Weight | 654.09 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(Cn2cc(CCO)nn2)c1 |
| InChI | InChI=1S/C32H31ClF3N7O3/c33-28-9-7-21(16-27(28)32(34,35)36)18-37-40-31(46)26-17-25(42-12-2-1-3-13-42)8-10-29(26)38-30(45)23-6-4-5-22(15-23)19-43-20-24(11-14-44)39-41-43/h4-10,15-18,20,44H,1-3,11-14,19H2,(H,38,45)(H,40,46)/b37-18+ |
| InChIKey | AQHPNIJPCKAURN-RQRWGXNHSA-N |
| XLogP | 5.54 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.09 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|