C31H32ClF3N4O4S — CID 66638250
N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide (PubChem CID 66638250) has the molecular formula C31H32ClF3N4O4S and a molecular weight of 649.14 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 66638250 |
| Molecular Formula | C31H32ClF3N4O4S |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(CO)CC2)cc1C(=O)NN=Cc1ccc(Cl)c(C(F)(F)F)c1)c1cccc(CSCCO)c1 |
| InChI | InChI=1S/C31H32ClF3N4O4S/c32-27-6-4-21(15-26(27)31(33,34)35)17-36-38-30(43)25-16-24(39-10-8-20(18-41)9-11-39)5-7-28(25)37-29(42)23-3-1-2-22(14-23)19-44-13-12-40/h1-7,14-17,20,40-41H,8-13,18-19H2,(H,37,42)(H,38,43) |
| InChIKey | KDTJDYRMQLFFRL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|