C33H33ClF3N7O3 — CID 87060854
N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(3-hydroxypropyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 87060854) has the molecular formula C33H33ClF3N7O3 and a molecular weight of 668.12 g/mol. Its IUPAC name is N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(3-hydroxypropyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(3-hydroxypropyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 87060854 |
| Molecular Formula | C33H33ClF3N7O3 |
| Molecular Weight | 668.12 g/mol |
| Exact Mass | 667.23 |
| IUPAC Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[4-(3-hydroxypropyl)triazol-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(Cn2cc(CCCO)nn2)c1 |
| InChI | InChI=1S/C33H33ClF3N7O3/c34-29-11-9-22(17-28(29)33(35,36)37)19-38-41-32(47)27-18-26(43-13-2-1-3-14-43)10-12-30(27)39-31(46)24-7-4-6-23(16-24)20-44-21-25(40-42-44)8-5-15-45/h4,6-7,9-12,16-19,21,45H,1-3,5,8,13-15,20H2,(H,39,46)(H,41,47)/b38-19+ |
| InChIKey | LIFOFRPCUZWHBP-OEPDXVHDSA-N |
| XLogP | 5.93 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.12 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|