C29H28ClF3N4O3S — CID 23108229
N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-pyrrolidin-1-ylbenzamide (PubChem CID 23108229) has the molecular formula C29H28ClF3N4O3S and a molecular weight of 605.08 g/mol. Its IUPAC name is N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 23108229 |
| Molecular Formula | C29H28ClF3N4O3S |
| Molecular Weight | 605.08 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-5-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(CSCCO)c1 |
| InChI | InChI=1S/C29H28ClF3N4O3S/c30-25-8-6-19(15-24(25)29(31,32)33)17-34-36-28(40)23-16-22(37-10-1-2-11-37)7-9-26(23)35-27(39)21-5-3-4-20(14-21)18-41-13-12-38/h3-9,14-17,38H,1-2,10-13,18H2,(H,35,39)(H,36,40)/b34-17+ |
| InChIKey | WLJFXTIBOJLAIT-KVAAJVFYSA-N |
| XLogP | 6.20 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.08 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|