C26H22BrClF3N5O2 — CID 87060810
6-bromo-N-[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]pyridine-2-carboxamide (PubChem CID 87060810) has the molecular formula C26H22BrClF3N5O2 and a molecular weight of 608.85 g/mol. Its IUPAC name is 6-bromo-N-[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87060810 |
| Molecular Formula | C26H22BrClF3N5O2 |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | 6-bromo-N-[2-[[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-4-piperidin-1-ylphenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(Br)n1 |
| InChI | InChI=1S/C26H22BrClF3N5O2/c27-23-6-4-5-22(33-23)25(38)34-21-10-8-17(36-11-2-1-3-12-36)14-18(21)24(37)35-32-15-16-7-9-20(28)19(13-16)26(29,30)31/h4-10,13-15H,1-3,11-12H2,(H,34,38)(H,35,37)/b32-15+ |
| InChIKey | WAESHDGECUYMPI-VWJSQJICSA-N |
| XLogP | 6.52 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|