C27H25Cl2F3N4O4 — CID 23107462
2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 23107462) has the molecular formula C27H25Cl2F3N4O4 and a molecular weight of 597.42 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107462 |
| Molecular Formula | C27H25Cl2F3N4O4 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxyethyl)amino]methyl]benzoyl]amino]-5-chloro-N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)N/N=C/c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(CN(CCO)CCO)c1 |
| InChI | InChI=1S/C27H25Cl2F3N4O4/c28-20-5-7-24(34-25(39)19-3-1-2-18(12-19)16-36(8-10-37)9-11-38)21(14-20)26(40)35-33-15-17-4-6-23(29)22(13-17)27(30,31)32/h1-7,12-15,37-38H,8-11,16H2,(H,34,39)(H,35,40)/b33-15+ |
| InChIKey | XSNRAHOYMYISHR-ROPCREHHSA-N |
| XLogP | 4.82 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|