C26H27ClN4O4 — CID 136614363
5-chloro-2-[[3-[[ethyl(2-hydroxyethyl)amino]methyl]benzoyl]amino]-N-[(4-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 136614363) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is 5-chloro-2-[[3-[[ethyl(2-hydroxyethyl)amino]methyl]benzoyl]amino]-N-[(4-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-chloro-2-[[3-[[ethyl(2-hydroxyethyl)amino]methyl]benzoyl]amino]-N-[(4-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136614363 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 5-chloro-2-[[3-[[ethyl(2-hydroxyethyl)amino]methyl]benzoyl]amino]-N-[(4-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | CCN(CCO)Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)NN=Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C26H27ClN4O4/c1-2-31(12-13-32)17-19-4-3-5-20(14-19)25(34)29-24-11-8-21(27)15-23(24)26(35)30-28-16-18-6-9-22(33)10-7-18/h3-11,14-16,32-33H,2,12-13,17H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | YUPREWULDRTJNZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|