C26H26ClN3O4 — CID 23107431
[[5-chloro-2-[[3-(diethylaminomethyl)benzoyl]amino]benzoyl]amino] benzoate (PubChem CID 23107431) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is [[5-chloro-2-[[3-(diethylaminomethyl)benzoyl]amino]benzoyl]amino] benzoate.
| Compound Name | [[5-chloro-2-[[3-(diethylaminomethyl)benzoyl]amino]benzoyl]amino] benzoate |
|---|---|
| PubChem CID | 23107431 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [[5-chloro-2-[[3-(diethylaminomethyl)benzoyl]amino]benzoyl]amino] benzoate |
| SMILES | CCN(CC)Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)NOC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-3-30(4-2)17-18-9-8-12-20(15-18)24(31)28-23-14-13-21(27)16-22(23)25(32)29-34-26(33)19-10-6-5-7-11-19/h5-16H,3-4,17H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | UXJXLVPKTLWQGY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|