C31H37BrN4O5 — CID 66637987
2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-methoxyphenyl)methylideneamino]benzamide (PubChem CID 66637987) has the molecular formula C31H37BrN4O5 and a molecular weight of 625.56 g/mol. Its IUPAC name is 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66637987 |
| Molecular Formula | C31H37BrN4O5 |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]amino]-5-bromo-N-[(3-methoxyphenyl)methylideneamino]benzamide |
| SMILES | CCOCCN(CCOCC)Cc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)NN=Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C31H37BrN4O5/c1-4-40-17-15-36(16-18-41-5-2)22-23-9-11-25(12-10-23)30(37)34-29-14-13-26(32)20-28(29)31(38)35-33-21-24-7-6-8-27(19-24)39-3/h6-14,19-21H,4-5,15-18,22H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | IVQHRMYZIFISMX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|