C27H29BrN4O3S — CID 23108099
5-bromo-2-[[4-[(2-ethylsulfanylethylamino)methyl]benzoyl]amino]-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide (PubChem CID 23108099) has the molecular formula C27H29BrN4O3S and a molecular weight of 569.53 g/mol. Its IUPAC name is 5-bromo-2-[[4-[(2-ethylsulfanylethylamino)methyl]benzoyl]amino]-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[(2-ethylsulfanylethylamino)methyl]benzoyl]amino]-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23108099 |
| Molecular Formula | C27H29BrN4O3S |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 5-bromo-2-[[4-[(2-ethylsulfanylethylamino)methyl]benzoyl]amino]-N-[(E)-(3-methoxyphenyl)methylideneamino]benzamide |
| SMILES | CCSCCNCc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)N/N=C/c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C27H29BrN4O3S/c1-3-36-14-13-29-17-19-7-9-21(10-8-19)26(33)31-25-12-11-22(28)16-24(25)27(34)32-30-18-20-5-4-6-23(15-20)35-2/h4-12,15-16,18,29H,3,13-14,17H2,1-2H3,(H,31,33)(H,32,34)/b30-18+ |
| InChIKey | OGECVOAQEUUWRZ-UXHLAJHPSA-N |
| XLogP | 5.32 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|