C37H51N5O6 — CID 66639019
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-[3-(diethylamino)-2-hydroxypropoxy]-N-[(3,4-dimethylphenyl)methylideneamino]benzamide (PubChem CID 66639019) has the molecular formula C37H51N5O6 and a molecular weight of 661.84 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-[3-(diethylamino)-2-hydroxypropoxy]-N-[(3,4-dimethylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-[3-(diethylamino)-2-hydroxypropoxy]-N-[(3,4-dimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66639019 |
| Molecular Formula | C37H51N5O6 |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.38 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-[3-(diethylamino)-2-hydroxypropoxy]-N-[(3,4-dimethylphenyl)methylideneamino]benzamide |
| SMILES | CCN(CC)CC(O)COc1ccc(NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)c(C(=O)NN=Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C37H51N5O6/c1-7-41(8-2)23-32(45)24-48-33-14-15-35(34(18-33)37(47)40-38-19-29-13-12-25(3)26(4)16-29)39-36(46)31-11-9-10-30(17-31)22-42(20-27(5)43)21-28(6)44/h9-19,27-28,32,43-45H,7-8,20-24H2,1-6H3,(H,39,46)(H,40,47) |
| InChIKey | UGUCBIMMKJSIKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|