C33H39FN6O3 — CID 66639324
N-[(3-fluorophenyl)methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 66639324) has the molecular formula C33H39FN6O3 and a molecular weight of 586.71 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | N-[(3-fluorophenyl)methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 66639324 |
| Molecular Formula | C33H39FN6O3 |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | N-[(3-fluorophenyl)methylideneamino]-2-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1C(=O)NN=Cc1cccc(F)c1)c1cccc(CN2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C33H39FN6O3/c34-28-9-5-6-25(21-28)23-35-37-33(43)30-22-29(40-12-2-1-3-13-40)10-11-31(30)36-32(42)27-8-4-7-26(20-27)24-39-16-14-38(15-17-39)18-19-41/h4-11,20-23,41H,1-3,12-19,24H2,(H,36,42)(H,37,43) |
| InChIKey | JIIUTOQWTDDCJN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|