C32H32FN5O3 — CID 23107339
N-[(E)-(3-fluorophenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]naphthalene-2-carboxamide (PubChem CID 23107339) has the molecular formula C32H32FN5O3 and a molecular weight of 553.64 g/mol. Its IUPAC name is N-[(E)-(3-fluorophenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-(3-fluorophenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 23107339 |
| Molecular Formula | C32H32FN5O3 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-[(E)-(3-fluorophenyl)methylideneamino]-3-[[3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoyl]amino]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1cc2ccccc2cc1C(=O)N/N=C/c1cccc(F)c1)c1cccc(CN2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C32H32FN5O3/c33-28-10-4-5-23(18-28)21-34-36-32(41)29-19-25-7-1-2-8-26(25)20-30(29)35-31(40)27-9-3-6-24(17-27)22-38-13-11-37(12-14-38)15-16-39/h1-10,17-21,39H,11-16,22H2,(H,35,40)(H,36,41)/b34-21+ |
| InChIKey | HTKMQZHWWFMEDZ-KEIPNQJHSA-N |
| XLogP | 4.11 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|