C29H32FN3O5S — CID 23107408
5-(4-fluorobutoxy)-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 23107408) has the molecular formula C29H32FN3O5S and a molecular weight of 553.66 g/mol. Its IUPAC name is 5-(4-fluorobutoxy)-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-(4-fluorobutoxy)-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107408 |
| Molecular Formula | C29H32FN3O5S |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 5-(4-fluorobutoxy)-2-[[3-(2-hydroxyethylsulfanylmethyl)benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(OCCCCF)ccc2NC(=O)c2cccc(CSCCO)c2)cc1 |
| InChI | InChI=1S/C29H32FN3O5S/c1-37-24-9-7-21(8-10-24)19-31-33-29(36)26-18-25(38-15-3-2-13-30)11-12-27(26)32-28(35)23-6-4-5-22(17-23)20-39-16-14-34/h4-12,17-19,34H,2-3,13-16,20H2,1H3,(H,32,35)(H,33,36)/b31-19+ |
| InChIKey | QPQGUHWHCRGEIV-ZCTHSVRISA-N |
| XLogP | 5.07 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|