C28H29ClN8O3S — CID 58712758
5-chloro-2-[[3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 58712758) has the molecular formula C28H29ClN8O3S and a molecular weight of 593.11 g/mol. Its IUPAC name is 5-chloro-2-[[3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 5-chloro-2-[[3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 58712758 |
| Molecular Formula | C28H29ClN8O3S |
| Molecular Weight | 593.11 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 5-chloro-2-[[3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]benzoyl]amino]-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(Cl)ccc2NC(=O)c2cccc(CSc3nnnn3CCN(C)C)c2)cc1 |
| InChI | InChI=1S/C28H29ClN8O3S/c1-36(2)13-14-37-28(33-34-35-37)41-18-20-5-4-6-21(15-20)26(38)31-25-12-9-22(29)16-24(25)27(39)32-30-17-19-7-10-23(40-3)11-8-19/h4-12,15-17H,13-14,18H2,1-3H3,(H,31,38)(H,32,39)/b30-17+ |
| InChIKey | MALNXHRNAWIIQK-OCSSWDANSA-N |
| XLogP | 4.21 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|