C23H21N3O4 — CID 4614561
2-[(4-methoxybenzoyl)amino]-N-[(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 4614561) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]-N-[(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-[(4-methoxybenzoyl)amino]-N-[(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4614561 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]-N-[(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(C=NNC(=O)c2ccccc2NC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-29-18-11-7-16(8-12-18)15-24-26-23(28)20-5-3-4-6-21(20)25-22(27)17-9-13-19(30-2)14-10-17/h3-15H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WCELGPUJPJRCBV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|