C24H27FN4O2S — CID 88588721
4-[[3-(diethylaminomethyl)benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-2,3-dihydrothiophene-5-carboxamide (PubChem CID 88588721) has the molecular formula C24H27FN4O2S and a molecular weight of 454.57 g/mol. Its IUPAC name is 4-[[3-(diethylaminomethyl)benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-2,3-dihydrothiophene-5-carboxamide.
| Compound Name | 4-[[3-(diethylaminomethyl)benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-2,3-dihydrothiophene-5-carboxamide |
|---|---|
| PubChem CID | 88588721 |
| Molecular Formula | C24H27FN4O2S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[[3-(diethylaminomethyl)benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-2,3-dihydrothiophene-5-carboxamide |
| SMILES | CCN(CC)Cc1cccc(C(=O)NC2=C(C(=O)N/N=C/c3cccc(F)c3)SCC2)c1 |
| InChI | InChI=1S/C24H27FN4O2S/c1-3-29(4-2)16-18-8-5-9-19(13-18)23(30)27-21-11-12-32-22(21)24(31)28-26-15-17-7-6-10-20(25)14-17/h5-10,13-15H,3-4,11-12,16H2,1-2H3,(H,27,30)(H,28,31)/b26-15+ |
| InChIKey | VEACPWPGRRIONC-CVKSISIWSA-N |
| XLogP | 3.90 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|