C33H45FN6O2S — CID 66637916
2-[[3-[[bis[2-(diethylamino)ethyl]amino]methyl]benzoyl]amino]-N-[(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide (PubChem CID 66637916) has the molecular formula C33H45FN6O2S and a molecular weight of 608.83 g/mol. Its IUPAC name is 2-[[3-[[bis[2-(diethylamino)ethyl]amino]methyl]benzoyl]amino]-N-[(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 2-[[3-[[bis[2-(diethylamino)ethyl]amino]methyl]benzoyl]amino]-N-[(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 66637916 |
| Molecular Formula | C33H45FN6O2S |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 2-[[3-[[bis[2-(diethylamino)ethyl]amino]methyl]benzoyl]amino]-N-[(4-fluorophenyl)methylideneamino]-4-methylthiophene-3-carboxamide |
| SMILES | CCN(CC)CCN(CCN(CC)CC)Cc1cccc(C(=O)Nc2scc(C)c2C(=O)NN=Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C33H45FN6O2S/c1-6-38(7-2)17-19-40(20-18-39(8-3)9-4)23-27-11-10-12-28(21-27)31(41)36-33-30(25(5)24-43-33)32(42)37-35-22-26-13-15-29(34)16-14-26/h10-16,21-22,24H,6-9,17-20,23H2,1-5H3,(H,36,41)(H,37,42) |
| InChIKey | ZGFBFJZRDFBUDV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|