C28H35N5O2S — CID 23107522
3-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 23107522) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is 3-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | 3-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23107522 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CCN(CC)CCNCc1cccc(C(=O)Nc2c(C)csc2C(=O)N/N=C/c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H35N5O2S/c1-5-33(6-2)15-14-29-17-23-8-7-9-24(16-23)27(34)31-25-21(4)19-36-26(25)28(35)32-30-18-22-12-10-20(3)11-13-22/h7-13,16,18-19,29H,5-6,14-15,17H2,1-4H3,(H,31,34)(H,32,35)/b30-18+ |
| InChIKey | IDTGVDCZHMFKDG-UXHLAJHPSA-N |
| XLogP | 4.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|