C28H34FN5O2S — CID 23107670
3-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4-methylthiophene-2-carboxamide (PubChem CID 23107670) has the molecular formula C28H34FN5O2S and a molecular weight of 523.68 g/mol. Its IUPAC name is 3-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4-methylthiophene-2-carboxamide.
| Compound Name | 3-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 23107670 |
| Molecular Formula | C28H34FN5O2S |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 3-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3-fluorophenyl)methylideneamino]-4-methylthiophene-2-carboxamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2c(C)csc2C(=O)N/N=C/c2cccc(F)c2)c1 |
| InChI | InChI=1S/C28H34FN5O2S/c1-5-34(6-2)14-13-33(4)18-22-10-7-11-23(15-22)27(35)31-25-20(3)19-37-26(25)28(36)32-30-17-21-9-8-12-24(29)16-21/h7-12,15-17,19H,5-6,13-14,18H2,1-4H3,(H,31,35)(H,32,36)/b30-17+ |
| InChIKey | YJBFVJSILZPSFP-OCSSWDANSA-N |
| XLogP | 4.99 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|