C30H33ClF3N5O2S — CID 23107974
N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 23107974) has the molecular formula C30H33ClF3N5O2S and a molecular weight of 620.14 g/mol. Its IUPAC name is N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 23107974 |
| Molecular Formula | C30H33ClF3N5O2S |
| Molecular Weight | 620.14 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | N-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethylamino]methyl]benzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | CCN(CC)CCNCc1cccc(C(=O)Nc2sc3c(c2C(=O)N/N=C/c2ccc(Cl)c(C(F)(F)F)c2)CCC3)c1 |
| InChI | InChI=1S/C30H33ClF3N5O2S/c1-3-39(4-2)14-13-35-17-19-7-5-8-21(15-19)27(40)37-29-26(22-9-6-10-25(22)42-29)28(41)38-36-18-20-11-12-24(31)23(16-20)30(32,33)34/h5,7-8,11-12,15-16,18,35H,3-4,6,9-10,13-14,17H2,1-2H3,(H,37,40)(H,38,41)/b36-18+ |
| InChIKey | GLAVUPKDQMWXHF-IZYHBKOJSA-N |
| XLogP | 6.36 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.14 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|