C20H15FN4O2 — CID 23107653
N-[2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 23107653) has the molecular formula C20H15FN4O2 and a molecular weight of 362.36 g/mol. Its IUPAC name is N-[2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23107653 |
| Molecular Formula | C20H15FN4O2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-[[(E)-(3-fluorophenyl)methylideneamino]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/N=C/c1cccc(F)c1)c1cccnc1 |
| InChI | InChI=1S/C20H15FN4O2/c21-16-7-3-5-14(11-16)12-23-25-20(27)17-8-1-2-9-18(17)24-19(26)15-6-4-10-22-13-15/h1-13H,(H,24,26)(H,25,27)/b23-12+ |
| InChIKey | BMNFRJDMHIKATC-FSJBWODESA-N |
| XLogP | 3.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|