C16H17N3O2 — CID 110705466
N-[2-(2,4-dimethylanilino)-2-oxoethyl]pyridine-3-carboxamide (PubChem CID 110705466) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[2-(2,4-dimethylanilino)-2-oxoethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2,4-dimethylanilino)-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110705466 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[2-(2,4-dimethylanilino)-2-oxoethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-11-5-6-14(12(2)8-11)19-15(20)10-18-16(21)13-4-3-7-17-9-13/h3-9H,10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | VILQIKLYMIGIMK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |