C22H21N5O2S — CID 10598173
N-[4-[[(2,3-dimethylphenyl)carbamothioylamino]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 10598173) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[4-[[(2,3-dimethylphenyl)carbamothioylamino]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[[(2,3-dimethylphenyl)carbamothioylamino]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10598173 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[4-[[(2,3-dimethylphenyl)carbamothioylamino]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=S)NNC(=O)c2ccc(NC(=O)c3cccnc3)cc2)c1C |
| InChI | InChI=1S/C22H21N5O2S/c1-14-5-3-7-19(15(14)2)25-22(30)27-26-21(29)16-8-10-18(11-9-16)24-20(28)17-6-4-12-23-13-17/h3-13H,1-2H3,(H,24,28)(H,26,29)(H2,25,27,30) |
| InChIKey | JGQFQDDTBATPJO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|