C15H14N4O2S — CID 930177
N-[4-(acetylcarbamothioylamino)phenyl]pyridine-3-carboxamide (PubChem CID 930177) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-[4-(acetylcarbamothioylamino)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(acetylcarbamothioylamino)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 930177 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-[4-(acetylcarbamothioylamino)phenyl]pyridine-3-carboxamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C15H14N4O2S/c1-10(20)17-15(22)19-13-6-4-12(5-7-13)18-14(21)11-3-2-8-16-9-11/h2-9H,1H3,(H,18,21)(H2,17,19,20,22) |
| InChIKey | GQLALWXRNCEAEI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|