C14H13N5O4S2 — CID 6611245
N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 6611245) has the molecular formula C14H13N5O4S2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6611245 |
| Molecular Formula | C14H13N5O4S2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | NC(=O)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C14H13N5O4S2/c15-13(21)19-25(22,23)11-5-3-10(4-6-11)17-14(24)18-12(20)9-2-1-7-16-8-9/h1-8H,(H3,15,19,21)(H2,17,18,20,24) |
| InChIKey | RTDMUAUYROTARN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|